C24H42O4Si — CID 11811908
tert-butyl-[(3R,4R,5R,6R)-6-[(3,4-dimethoxyphenyl)methoxy]-3,5-dimethylhept-1-en-4-yl]oxy-dimethylsilane (PubChem CID 11811908) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,5R,6R)-6-[(3,4-dimethoxyphenyl)methoxy]-3,5-dimethylhept-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,5R,6R)-6-[(3,4-dimethoxyphenyl)methoxy]-3,5-dimethylhept-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11811908 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | tert-butyl-[(3R,4R,5R,6R)-6-[(3,4-dimethoxyphenyl)methoxy]-3,5-dimethylhept-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)[C@@H](C)OCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H42O4Si/c1-12-17(2)23(28-29(10,11)24(5,6)7)18(3)19(4)27-16-20-13-14-21(25-8)22(15-20)26-9/h12-15,17-19,23H,1,16H2,2-11H3/t17-,18?,19-,23-/m1/s1 |
| InChIKey | YBJNEOUJARLOSG-ZGXRDTPRSA-N |
| XLogP | 6.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|