C39H58O5Si2 — CID 101039117
tert-butyl-[(2R,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(3,4-dimethoxyphenyl)methoxy]-2-methylhex-5-enoxy]-diphenylsilane (PubChem CID 101039117) has the molecular formula C39H58O5Si2 and a molecular weight of 663.06 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(3,4-dimethoxyphenyl)methoxy]-2-methylhex-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(3,4-dimethoxyphenyl)methoxy]-2-methylhex-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101039117 |
| Molecular Formula | C39H58O5Si2 |
| Molecular Weight | 663.06 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | tert-butyl-[(2R,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(3,4-dimethoxyphenyl)methoxy]-2-methylhex-5-enoxy]-diphenylsilane |
| SMILES | C=C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc1ccc(OC)c(OC)c1)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H58O5Si2/c1-13-32(29-43-45(11,12)38(3,4)5)37(42-28-31-24-25-35(40-9)36(26-31)41-10)30(2)27-44-46(39(6,7)8,33-20-16-14-17-21-33)34-22-18-15-19-23-34/h13-26,30,32,37H,1,27-29H2,2-12H3/t30-,32+,37+/m1/s1 |
| InChIKey | MTGZPMWKRBLXSJ-IDOZNTNQSA-N |
| XLogP | 8.63 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.06 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|