C25H42O6Si — CID 102507183
methyl (E,4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(3,4-dimethoxyphenyl)methoxy]-4,6-dimethylhept-2-enoate (PubChem CID 102507183) has the molecular formula C25H42O6Si and a molecular weight of 466.69 g/mol. Its IUPAC name is methyl (E,4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(3,4-dimethoxyphenyl)methoxy]-4,6-dimethylhept-2-enoate.
| Compound Name | methyl (E,4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(3,4-dimethoxyphenyl)methoxy]-4,6-dimethylhept-2-enoate |
|---|---|
| PubChem CID | 102507183 |
| Molecular Formula | C25H42O6Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | methyl (E,4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(3,4-dimethoxyphenyl)methoxy]-4,6-dimethylhept-2-enoate |
| SMILES | COC(=O)/C=C/C(C)[C@@H](OCc1ccc(OC)c(OC)c1)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O6Si/c1-18(11-14-23(26)29-8)24(19(2)16-31-32(9,10)25(3,4)5)30-17-20-12-13-21(27-6)22(15-20)28-7/h11-15,18-19,24H,16-17H2,1-10H3/b14-11+/t18?,19-,24-/m1/s1 |
| InChIKey | MVVOOUABILNHPR-UZKINQEBSA-N |
| XLogP | 5.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|