C19H21ClO4 — CID 25215400
4-[1-[(4-chlorophenyl)methoxy]prop-2-enoxymethyl]-1,2-dimethoxybenzene (PubChem CID 25215400) has the molecular formula C19H21ClO4 and a molecular weight of 348.83 g/mol. Its IUPAC name is 4-[1-[(4-chlorophenyl)methoxy]prop-2-enoxymethyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[1-[(4-chlorophenyl)methoxy]prop-2-enoxymethyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 25215400 |
| Molecular Formula | C19H21ClO4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-[1-[(4-chlorophenyl)methoxy]prop-2-enoxymethyl]-1,2-dimethoxybenzene |
| SMILES | C=CC(OCc1ccc(Cl)cc1)OCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H21ClO4/c1-4-19(23-12-14-5-8-16(20)9-6-14)24-13-15-7-10-17(21-2)18(11-15)22-3/h4-11,19H,1,12-13H2,2-3H3 |
| InChIKey | SHOHXSUIDJEJDZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|