C24H52O3Si2 — CID 52912234
(3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-3-triethylsilyloxydec-9-en-1-ol (PubChem CID 52912234) has the molecular formula C24H52O3Si2 and a molecular weight of 444.85 g/mol. Its IUPAC name is (3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-3-triethylsilyloxydec-9-en-1-ol.
| Compound Name | (3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-3-triethylsilyloxydec-9-en-1-ol |
|---|---|
| PubChem CID | 52912234 |
| Molecular Formula | C24H52O3Si2 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | (3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-3-triethylsilyloxydec-9-en-1-ol |
| SMILES | C=CCC[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](CCO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H52O3Si2/c1-12-16-17-20(5)23(27-28(10,11)24(7,8)9)21(6)22(18-19-25)26-29(13-2,14-3)15-4/h12,20-23,25H,1,13-19H2,2-11H3/t20-,21-,22-,23-/m1/s1 |
| InChIKey | IOSHDALJYZQXLA-SSGKUCQKSA-N |
| XLogP | 7.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|