C35H63NO3SSi2 — CID 102146334
[(1S,2R,3E,5R)-1-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylnona-3,8-dienoxy]-triethylsilane (PubChem CID 102146334) has the molecular formula C35H63NO3SSi2 and a molecular weight of 634.13 g/mol. Its IUPAC name is [(1S,2R,3E,5R)-1-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylnona-3,8-dienoxy]-triethylsilane.
| Compound Name | [(1S,2R,3E,5R)-1-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylnona-3,8-dienoxy]-triethylsilane |
|---|---|
| PubChem CID | 102146334 |
| Molecular Formula | C35H63NO3SSi2 |
| Molecular Weight | 634.13 g/mol |
| Exact Mass | 633.41 |
| IUPAC Name | [(1S,2R,3E,5R)-1-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylnona-3,8-dienoxy]-triethylsilane |
| SMILES | C=CCC[C@H](O[Si](CC)(CC)CC)[C@@H](/C=C(\[C@@H](CCC=C)O[Si](C)(C)C(C)(C)C)S(=O)(=NC)c1ccccc1)C(C)C |
| InChI | InChI=1S/C35H63NO3SSi2/c1-14-19-26-32(39-42(16-3,17-4)18-5)31(29(6)7)28-34(40(37,36-11)30-24-22-21-23-25-30)33(27-20-15-2)38-41(12,13)35(8,9)10/h14-15,21-25,28-29,31-33H,1-2,16-20,26-27H2,3-13H3/b34-28+/t31-,32-,33+,40?/m0/s1 |
| InChIKey | CJBYFLPKMKPSCX-JFQIRFOBSA-N |
| XLogP | 11.01 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.13 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|