C34H61NO3SSi2 — CID 102146333
tert-butyl-dimethyl-[(5S,6E,8R,9S,10E)-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxydodeca-1,6,10-trien-5-yl]oxysilane (PubChem CID 102146333) has the molecular formula C34H61NO3SSi2 and a molecular weight of 620.11 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5S,6E,8R,9S,10E)-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxydodeca-1,6,10-trien-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(5S,6E,8R,9S,10E)-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxydodeca-1,6,10-trien-5-yl]oxysilane |
|---|---|
| PubChem CID | 102146333 |
| Molecular Formula | C34H61NO3SSi2 |
| Molecular Weight | 620.11 g/mol |
| Exact Mass | 619.39 |
| IUPAC Name | tert-butyl-dimethyl-[(5S,6E,8R,9S,10E)-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxydodeca-1,6,10-trien-5-yl]oxysilane |
| SMILES | C=CCC[C@H](O[Si](C)(C)C(C)(C)C)/C(=C\[C@@H](C(C)C)[C@H](/C=C/C)O[Si](CC)(CC)CC)S(=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C34H61NO3SSi2/c1-14-19-26-32(37-40(12,13)34(8,9)10)33(39(36,35-11)29-24-21-20-22-25-29)27-30(28(6)7)31(23-15-2)38-41(16-3,17-4)18-5/h14-15,20-25,27-28,30-32H,1,16-19,26H2,2-13H3/b23-15+,33-27+/t30-,31-,32-,39?/m0/s1 |
| InChIKey | VOGBSZBARNAZCK-FNMKXZHGSA-N |
| XLogP | 10.62 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.11 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|