C13H19NO2S — CID 10515054
(Z,2R,3R)-3-(N-methyl-S-phenylsulfonimidoyl)hex-4-en-2-ol (PubChem CID 10515054) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is (Z,2R,3R)-3-(N-methyl-S-phenylsulfonimidoyl)hex-4-en-2-ol.
| Compound Name | (Z,2R,3R)-3-(N-methyl-S-phenylsulfonimidoyl)hex-4-en-2-ol |
|---|---|
| PubChem CID | 10515054 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (Z,2R,3R)-3-(N-methyl-S-phenylsulfonimidoyl)hex-4-en-2-ol |
| SMILES | C/C=C\[C@H]([C@@H](C)O)S(=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C13H19NO2S/c1-4-8-13(11(2)15)17(16,14-3)12-9-6-5-7-10-12/h4-11,13,15H,1-3H3/b8-4-/t11-,13-,17?/m1/s1 |
| InChIKey | ZZZTVBJVDNCKGH-MBRYOIQSSA-N |
| XLogP | 2.47 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|