C13H19NOS — CID 10823803
[(Z)-2-ethylbut-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane (PubChem CID 10823803) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is [(Z)-2-ethylbut-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane.
| Compound Name | [(Z)-2-ethylbut-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 10823803 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [(Z)-2-ethylbut-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane |
| SMILES | C/C=C(/CC)CS(=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C13H19NOS/c1-4-12(5-2)11-16(15,14-3)13-9-7-6-8-10-13/h4,6-10H,5,11H2,1-3H3/b12-4- |
| InChIKey | ZTYVGBIHGPEZAE-QCDXTXTGSA-N |
| XLogP | 3.50 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|