C22H23NO2S — CID 25041032
1-(N-methyl-S-phenylsulfonimidoyl)-2,3-diphenylpropan-2-ol (PubChem CID 25041032) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-(N-methyl-S-phenylsulfonimidoyl)-2,3-diphenylpropan-2-ol.
| Compound Name | 1-(N-methyl-S-phenylsulfonimidoyl)-2,3-diphenylpropan-2-ol |
|---|---|
| PubChem CID | 25041032 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-(N-methyl-S-phenylsulfonimidoyl)-2,3-diphenylpropan-2-ol |
| SMILES | CN=[S@](=O)(CC(O)(Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23NO2S/c1-23-26(25,21-15-9-4-10-16-21)18-22(24,20-13-7-3-8-14-20)17-19-11-5-2-6-12-19/h2-16,24H,17-18H2,1H3/t22?,26-/m0/s1 |
| InChIKey | CQQCVHCHPYNYFT-XGCAABAXSA-N |
| XLogP | 4.27 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |