About [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane
[(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane (PubChem CID 101351722) has the molecular formula C14H21NOS
and a molecular weight of 251.40 g/mol. Its IUPAC name is [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane.
Molecular Properties
| Compound Name | [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane |
| PubChem CID | 101351722 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane |
| SMILES | CN=S(=O)(C/C=C/C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H21NOS/c1-14(2,3)11-8-12-17(16,15-4)13-9-6-5-7-10-13/h5-11H,12H2,1-4H3/b11-8+ |
| InChIKey | XQEXFDYKDAVFOZ-DHZHZOJOSA-N |
| XLogP | 3.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane?
The IUPAC name of [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane (CID 101351722) is [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane.
What is the SMILES notation for [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane?
The canonical SMILES for [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane is CN=S(=O)(C/C=C/C(C)(C)C)c1ccccc1.
What is the InChIKey of [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane?
The InChIKey is XQEXFDYKDAVFOZ-DHZHZOJOSA-N. The full InChI is InChI=1S/C14H21NOS/c1-14(2,3)11-8-12-17(16,15-4)13-9-6-5-7-10-13/h5-11H,12H2,1-4H3/b11-8+.
What are the key properties of [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane?
[(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane has a molecular weight of 251.40 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,4-dimethylpent-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane is sourced from PubChem (CID 101351722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).