About [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane
[(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane (PubChem CID 122208778) has the molecular formula C19H27NOSSi
and a molecular weight of 345.58 g/mol. Its IUPAC name is [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane.
Molecular Properties
| Compound Name | [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane |
| PubChem CID | 122208778 |
| Molecular Formula | C19H27NOSSi |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane |
| SMILES | CC[Si](CC)(CC)N=S(=O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H27NOSSi/c1-4-23(5-2,6-3)20-22(21,19-15-11-8-12-16-19)17-18-13-9-7-10-14-18/h7-16H,4-6,17H2,1-3H3 |
| InChIKey | OKFVPOBSYDNQHA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane?
The IUPAC name of [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane (CID 122208778) is [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane.
What is the SMILES notation for [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane?
The canonical SMILES for [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane is CC[Si](CC)(CC)N=S(=O)(Cc1ccccc1)c1ccccc1.
What is the InChIKey of [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane?
The InChIKey is OKFVPOBSYDNQHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NOSSi/c1-4-23(5-2,6-3)20-22(21,19-15-11-8-12-16-19)17-18-13-9-7-10-14-18/h7-16H,4-6,17H2,1-3H3.
What are the key properties of [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane?
[(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane has a molecular weight of 345.58 g/mol, XLogP of 5.72, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-triethylsilane is sourced from PubChem (CID 122208778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).