About N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide
N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide (PubChem CID 121219437) has the molecular formula C11H17NO2S2
and a molecular weight of 259.40 g/mol. Its IUPAC name is N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide |
| PubChem CID | 121219437 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide |
| SMILES | CCS(CC)=NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H17NO2S2/c1-3-15(4-2)12-16(13,14)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | ZGRWLMDUFPDMKX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide?
The IUPAC name of N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide (CID 121219437) is N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide.
What is the SMILES notation for N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide?
The canonical SMILES for N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide is CCS(CC)=NS(=O)(=O)Cc1ccccc1.
What is the InChIKey of N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide?
The InChIKey is ZGRWLMDUFPDMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S2/c1-3-15(4-2)12-16(13,14)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3.
What are the key properties of N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide?
N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide has a molecular weight of 259.40 g/mol, XLogP of 2.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diethyl-λ4-sulfanylidene)-1-phenylmethanesulfonamide is sourced from PubChem (CID 121219437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).