C13H20O4S — CID 64641584
2,2-diethoxyethylsulfonylmethylbenzene (PubChem CID 64641584) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2,2-diethoxyethylsulfonylmethylbenzene.
| Compound Name | 2,2-diethoxyethylsulfonylmethylbenzene |
|---|---|
| PubChem CID | 64641584 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2,2-diethoxyethylsulfonylmethylbenzene |
| SMILES | CCOC(CS(=O)(=O)Cc1ccccc1)OCC |
| InChI | InChI=1S/C13H20O4S/c1-3-16-13(17-4-2)11-18(14,15)10-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3 |
| InChIKey | LTYMGPJCUBYQEV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|