C16H23NOS — CID 10683958
[(E)-3-cyclohexylprop-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane (PubChem CID 10683958) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is [(E)-3-cyclohexylprop-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane.
| Compound Name | [(E)-3-cyclohexylprop-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 10683958 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [(E)-3-cyclohexylprop-2-enyl]-methylimino-oxo-phenyl-λ6-sulfane |
| SMILES | CN=S(=O)(C/C=C/C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H23NOS/c1-17-19(18,16-12-6-3-7-13-16)14-8-11-15-9-4-2-5-10-15/h3,6-8,11-13,15H,2,4-5,9-10,14H2,1H3/b11-8+ |
| InChIKey | MHFQKHKKERFOJH-DHZHZOJOSA-N |
| XLogP | 4.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|