About methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane
methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane (PubChem CID 10493393) has the molecular formula C17H19NOS
and a molecular weight of 285.41 g/mol. Its IUPAC name is methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane.
Molecular Properties
| Compound Name | methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane |
| PubChem CID | 10493393 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane |
| SMILES | C/C=C(\CS(=O)(=NC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NOS/c1-3-15(16-10-6-4-7-11-16)14-20(19,18-2)17-12-8-5-9-13-17/h3-13H,14H2,1-2H3/b15-3+ |
| InChIKey | VUQNPOBAUCCXDR-CRKCGEKBSA-N |
| XLogP | 4.25 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane?
The IUPAC name of methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane (CID 10493393) is methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane.
What is the SMILES notation for methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane?
The canonical SMILES for methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane is C/C=C(\CS(=O)(=NC)c1ccccc1)c1ccccc1.
What is the InChIKey of methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane?
The InChIKey is VUQNPOBAUCCXDR-CRKCGEKBSA-N. The full InChI is InChI=1S/C17H19NOS/c1-3-15(16-10-6-4-7-11-16)14-20(19,18-2)17-12-8-5-9-13-17/h3-13H,14H2,1-2H3/b15-3+.
What are the key properties of methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane?
methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane has a molecular weight of 285.41 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylimino-oxo-phenyl-[(Z)-2-phenylbut-2-enyl]-λ6-sulfane is sourced from PubChem (CID 10493393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).