C21H35NO4Si — CID 70085517
(2S)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutanoyl]amino]-3-methylbutanoic acid (PubChem CID 70085517) has the molecular formula C21H35NO4Si and a molecular weight of 393.60 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 70085517 |
| Molecular Formula | C21H35NO4Si |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (2S)-2-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C21H35NO4Si/c1-15(2)18(20(24)25)22-19(23)17(26-27(6,7)21(3,4)5)14-13-16-11-9-8-10-12-16/h8-12,15,17-18H,13-14H2,1-7H3,(H,22,23)(H,24,25)/t17-,18+/m1/s1 |
| InChIKey | AEQDXDXSXKYVBQ-MSOLQXFVSA-N |
| XLogP | 4.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|