C18H36O3SSi — CID 10904504
S-ethyl (3S,4R,5R)-3-hydroxy-4-methyl-5-triethylsilyloxynon-8-enethioate (PubChem CID 10904504) has the molecular formula C18H36O3SSi and a molecular weight of 360.64 g/mol. Its IUPAC name is S-ethyl (3S,4R,5R)-3-hydroxy-4-methyl-5-triethylsilyloxynon-8-enethioate.
| Compound Name | S-ethyl (3S,4R,5R)-3-hydroxy-4-methyl-5-triethylsilyloxynon-8-enethioate |
|---|---|
| PubChem CID | 10904504 |
| Molecular Formula | C18H36O3SSi |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | S-ethyl (3S,4R,5R)-3-hydroxy-4-methyl-5-triethylsilyloxynon-8-enethioate |
| SMILES | C=CCC[C@@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O)CC(=O)SCC |
| InChI | InChI=1S/C18H36O3SSi/c1-7-12-13-17(21-23(9-3,10-4)11-5)15(6)16(19)14-18(20)22-8-2/h7,15-17,19H,1,8-14H2,2-6H3/t15-,16+,17-/m1/s1 |
| InChIKey | MDDQOMTXIPFHMA-IXDOHACOSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|