C20H44O3Si2 — CID 11811175
(2S,3S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-trimethylsilyloxyoctanal (PubChem CID 11811175) has the molecular formula C20H44O3Si2 and a molecular weight of 388.74 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-trimethylsilyloxyoctanal.
| Compound Name | (2S,3S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-trimethylsilyloxyoctanal |
|---|---|
| PubChem CID | 11811175 |
| Molecular Formula | C20H44O3Si2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (2S,3S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-trimethylsilyloxyoctanal |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C20H44O3Si2/c1-13-15(2)18(23-25(11,12)20(5,6)7)17(4)19(16(3)14-21)22-24(8,9)10/h14-19H,13H2,1-12H3/t15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | KEZBGMXHFFCYLY-ZWJWXYIHSA-N |
| XLogP | 6.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|