C36H76O2Si2Sn — CID 11061557
[(1R,2S,3R,4R,5E,7E)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-8-tributylstannyl-3-trimethylsilyloxyocta-5,7-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 11061557) has the molecular formula C36H76O2Si2Sn and a molecular weight of 715.88 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5E,7E)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-8-tributylstannyl-3-trimethylsilyloxyocta-5,7-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S,3R,4R,5E,7E)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-8-tributylstannyl-3-trimethylsilyloxyocta-5,7-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11061557 |
| Molecular Formula | C36H76O2Si2Sn |
| Molecular Weight | 715.88 g/mol |
| Exact Mass | 716.44 |
| IUPAC Name | [(1R,2S,3R,4R,5E,7E)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-8-tributylstannyl-3-trimethylsilyloxyocta-5,7-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](/C=C/C(C)=C/[C@@H](C)[C@@H](O[Si](C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC)(CCCC)CCCC |
| InChI | InChI=1S/C24H49O2Si2.3C4H9.Sn/c1-15-18(3)17-20(5)23(25-27(10,11)12)21(6)22(19(4)16-2)26-28(13,14)24(7,8)9;3*1-3-4-2;/h1,15,17,19-23H,16H2,2-14H3;3*1,3-4H2,2H3;/b15-1?,18-17+;;;;/t19-,20+,21-,22+,23+;;;;/m0..../s1 |
| InChIKey | IFAOANDQEBCMAC-NNDJSCGGSA-N |
| XLogP | 12.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.88 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|