C20H26OSi — CID 102436050
[(3R,4S)-4-methoxy-5-phenylpent-1-en-3-yl]-dimethyl-phenylsilane (PubChem CID 102436050) has the molecular formula C20H26OSi and a molecular weight of 310.51 g/mol. Its IUPAC name is [(3R,4S)-4-methoxy-5-phenylpent-1-en-3-yl]-dimethyl-phenylsilane.
| Compound Name | [(3R,4S)-4-methoxy-5-phenylpent-1-en-3-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 102436050 |
| Molecular Formula | C20H26OSi |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(3R,4S)-4-methoxy-5-phenylpent-1-en-3-yl]-dimethyl-phenylsilane |
| SMILES | C=C[C@H]([C@H](Cc1ccccc1)OC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H26OSi/c1-5-20(22(3,4)18-14-10-7-11-15-18)19(21-2)16-17-12-8-6-9-13-17/h5-15,19-20H,1,16H2,2-4H3/t19-,20+/m0/s1 |
| InChIKey | PYAVDKLKCRSGBQ-VQTJNVASSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|