C15H23NOSi — CID 102391934
(Z,4S)-4-[dimethyl(phenyl)silyl]-N-methoxyhex-5-en-1-imine (PubChem CID 102391934) has the molecular formula C15H23NOSi and a molecular weight of 261.44 g/mol. Its IUPAC name is (Z,4S)-4-[dimethyl(phenyl)silyl]-N-methoxyhex-5-en-1-imine.
| Compound Name | (Z,4S)-4-[dimethyl(phenyl)silyl]-N-methoxyhex-5-en-1-imine |
|---|---|
| PubChem CID | 102391934 |
| Molecular Formula | C15H23NOSi |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (Z,4S)-4-[dimethyl(phenyl)silyl]-N-methoxyhex-5-en-1-imine |
| SMILES | C=C[C@H](CC/C=N\OC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H23NOSi/c1-5-14(12-9-13-16-17-2)18(3,4)15-10-7-6-8-11-15/h5-8,10-11,13-14H,1,9,12H2,2-4H3/b16-13-/t14-/m1/s1 |
| InChIKey | HDGUPVKAXDQCRB-UMWKZLPKSA-N |
| XLogP | 3.57 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|