C16H24O2Si — CID 135804698
methyl (3S)-3-[(1S)-1-[dimethyl(phenyl)silyl]ethyl]pent-4-enoate (PubChem CID 135804698) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is methyl (3S)-3-[(1S)-1-[dimethyl(phenyl)silyl]ethyl]pent-4-enoate.
| Compound Name | methyl (3S)-3-[(1S)-1-[dimethyl(phenyl)silyl]ethyl]pent-4-enoate |
|---|---|
| PubChem CID | 135804698 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl (3S)-3-[(1S)-1-[dimethyl(phenyl)silyl]ethyl]pent-4-enoate |
| SMILES | C=C[C@H](CC(=O)OC)[C@H](C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24O2Si/c1-6-14(12-16(17)18-3)13(2)19(4,5)15-10-8-7-9-11-15/h6-11,13-14H,1,12H2,2-5H3/t13-,14+/m0/s1 |
| InChIKey | PXWQBBNFDMRGRM-UONOGXRCSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|