C33H46O3Si2 — CID 10745173
methyl (3S,6S,8R)-3,6-bis[dimethyl(phenyl)silyl]-8-phenylmethoxynonanoate (PubChem CID 10745173) has the molecular formula C33H46O3Si2 and a molecular weight of 546.90 g/mol. Its IUPAC name is methyl (3S,6S,8R)-3,6-bis[dimethyl(phenyl)silyl]-8-phenylmethoxynonanoate.
| Compound Name | methyl (3S,6S,8R)-3,6-bis[dimethyl(phenyl)silyl]-8-phenylmethoxynonanoate |
|---|---|
| PubChem CID | 10745173 |
| Molecular Formula | C33H46O3Si2 |
| Molecular Weight | 546.90 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | methyl (3S,6S,8R)-3,6-bis[dimethyl(phenyl)silyl]-8-phenylmethoxynonanoate |
| SMILES | COC(=O)C[C@H](CCC(C[C@@H](C)OCc1ccccc1)[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C33H46O3Si2/c1-27(36-26-28-16-10-7-11-17-28)24-31(37(3,4)29-18-12-8-13-19-29)22-23-32(25-33(34)35-2)38(5,6)30-20-14-9-15-21-30/h7-21,27,31-32H,22-26H2,1-6H3/t27-,31?,32+/m1/s1 |
| InChIKey | RVNGLCZVBFGKRP-NZFOUTAESA-N |
| XLogP | 7.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.90 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|