C24H42OSi2 — CID 135063038
[(1S,2R)-1-cyclohexyl-2-[dimethyl(phenyl)silyl]but-3-enoxy]-triethylsilane (PubChem CID 135063038) has the molecular formula C24H42OSi2 and a molecular weight of 402.77 g/mol. Its IUPAC name is [(1S,2R)-1-cyclohexyl-2-[dimethyl(phenyl)silyl]but-3-enoxy]-triethylsilane.
| Compound Name | [(1S,2R)-1-cyclohexyl-2-[dimethyl(phenyl)silyl]but-3-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 135063038 |
| Molecular Formula | C24H42OSi2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(1S,2R)-1-cyclohexyl-2-[dimethyl(phenyl)silyl]but-3-enoxy]-triethylsilane |
| SMILES | C=C[C@H]([C@@H](O[Si](CC)(CC)CC)C1CCCCC1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H42OSi2/c1-7-23(26(5,6)22-19-15-12-16-20-22)24(21-17-13-11-14-18-21)25-27(8-2,9-3)10-4/h7,12,15-16,19-21,23-24H,1,8-11,13-14,17-18H2,2-6H3/t23-,24+/m1/s1 |
| InChIKey | ALCNNRXPXJUBAS-RPWUZVMVSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|