C17H25N2OP — CID 23421674
(3aR,7aR)-1,3-dimethyl-2-[(1S)-1-phenylprop-2-enoxy]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole (PubChem CID 23421674) has the molecular formula C17H25N2OP and a molecular weight of 304.37 g/mol. Its IUPAC name is (3aR,7aR)-1,3-dimethyl-2-[(1S)-1-phenylprop-2-enoxy]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole.
| Compound Name | (3aR,7aR)-1,3-dimethyl-2-[(1S)-1-phenylprop-2-enoxy]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole |
|---|---|
| PubChem CID | 23421674 |
| Molecular Formula | C17H25N2OP |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (3aR,7aR)-1,3-dimethyl-2-[(1S)-1-phenylprop-2-enoxy]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole |
| SMILES | C=C[C@H](OP1N(C)[C@@H]2CCCC[C@H]2N1C)c1ccccc1 |
| InChI | InChI=1S/C17H25N2OP/c1-4-17(14-10-6-5-7-11-14)20-21-18(2)15-12-8-9-13-16(15)19(21)3/h4-7,10-11,15-17H,1,8-9,12-13H2,2-3H3/t15-,16-,17+/m1/s1 |
| InChIKey | GPAUQKZJHVVEOD-ZACQAIPSSA-N |
| XLogP | 4.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|