C19H32N3OP — CID 15142991
(1S,2R)-1-[[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-N,N-dimethyl-1-phenylpropan-2-amine (PubChem CID 15142991) has the molecular formula C19H32N3OP and a molecular weight of 349.46 g/mol. Its IUPAC name is (1S,2R)-1-[[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-N,N-dimethyl-1-phenylpropan-2-amine.
| Compound Name | (1S,2R)-1-[[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-N,N-dimethyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 15142991 |
| Molecular Formula | C19H32N3OP |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (1S,2R)-1-[[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]oxy]-N,N-dimethyl-1-phenylpropan-2-amine |
| SMILES | C[C@H]([C@@H](OP1N(C)[C@@H]2CCCC[C@H]2N1C)c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H32N3OP/c1-15(20(2)3)19(16-11-7-6-8-12-16)23-24-21(4)17-13-9-10-14-18(17)22(24)5/h6-8,11-12,15,17-19H,9-10,13-14H2,1-5H3/t15-,17-,18-,19-/m1/s1 |
| InChIKey | ZCPBDUADCSJLIP-NXWXRZEISA-N |
| XLogP | 4.11 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|