C18H31N3O — CID 11120307
[(1S,2S)-2-(dimethylamino)-1-phenylpropyl] N,N'-di(propan-2-yl)carbamimidate (PubChem CID 11120307) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is [(1S,2S)-2-(dimethylamino)-1-phenylpropyl] N,N'-di(propan-2-yl)carbamimidate.
| Compound Name | [(1S,2S)-2-(dimethylamino)-1-phenylpropyl] N,N'-di(propan-2-yl)carbamimidate |
|---|---|
| PubChem CID | 11120307 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | [(1S,2S)-2-(dimethylamino)-1-phenylpropyl] N,N'-di(propan-2-yl)carbamimidate |
| SMILES | CC(C)/N=C(\NC(C)C)O[C@@H](c1ccccc1)[C@H](C)N(C)C |
| InChI | InChI=1S/C18H31N3O/c1-13(2)19-18(20-14(3)4)22-17(15(5)21(6)7)16-11-9-8-10-12-16/h8-15,17H,1-7H3,(H,19,20)/t15-,17+/m0/s1 |
| InChIKey | CBUZUGKDUIATQJ-DOTOQJQBSA-N |
| XLogP | 3.46 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|