C14H19NO — CID 11138555
(1R,2S)-N,N-dimethyl-1-phenyl-1-propa-1,2-dienoxypropan-2-amine (PubChem CID 11138555) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (1R,2S)-N,N-dimethyl-1-phenyl-1-propa-1,2-dienoxypropan-2-amine.
| Compound Name | (1R,2S)-N,N-dimethyl-1-phenyl-1-propa-1,2-dienoxypropan-2-amine |
|---|---|
| PubChem CID | 11138555 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1R,2S)-N,N-dimethyl-1-phenyl-1-propa-1,2-dienoxypropan-2-amine |
| SMILES | C=C=CO[C@H](c1ccccc1)[C@H](C)N(C)C |
| InChI | InChI=1S/C14H19NO/c1-5-11-16-14(12(2)15(3)4)13-9-7-6-8-10-13/h6-12,14H,1H2,2-4H3/t12-,14-/m0/s1 |
| InChIKey | IQMJTUWMNKRJPE-JSGCOSHPSA-N |
| XLogP | 2.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|