C19H25NO2 — CID 139888708
(1R)-1-[(1R,2R)-2-methoxy-1,2-diphenylethoxy]-N,N-dimethylethanamine (PubChem CID 139888708) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R)-1-[(1R,2R)-2-methoxy-1,2-diphenylethoxy]-N,N-dimethylethanamine.
| Compound Name | (1R)-1-[(1R,2R)-2-methoxy-1,2-diphenylethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 139888708 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R)-1-[(1R,2R)-2-methoxy-1,2-diphenylethoxy]-N,N-dimethylethanamine |
| SMILES | CO[C@H](c1ccccc1)[C@H](O[C@H](C)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-15(20(2)3)22-19(17-13-9-6-10-14-17)18(21-4)16-11-7-5-8-12-16/h5-15,18-19H,1-4H3/t15-,18-,19-/m1/s1 |
| InChIKey | RLUGHEGYVWIHKW-ATZDWAIDSA-N |
| XLogP | 4.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|