C18H22O2 — CID 10400953
[(1R,2R,3R)-1,3-dimethoxy-1-phenylbutan-2-yl]benzene (PubChem CID 10400953) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(1R,2R,3R)-1,3-dimethoxy-1-phenylbutan-2-yl]benzene.
| Compound Name | [(1R,2R,3R)-1,3-dimethoxy-1-phenylbutan-2-yl]benzene |
|---|---|
| PubChem CID | 10400953 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [(1R,2R,3R)-1,3-dimethoxy-1-phenylbutan-2-yl]benzene |
| SMILES | CO[C@H](C)[C@@H](c1ccccc1)[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C18H22O2/c1-14(19-2)17(15-10-6-4-7-11-15)18(20-3)16-12-8-5-9-13-16/h4-14,17-18H,1-3H3/t14-,17+,18+/m1/s1 |
| InChIKey | DRLSPUOEMIFQLS-JLSDUUJJSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |