C28H29NOSi — CID 102215132
(1R,2S)-1-methoxy-1-phenyl-N-triphenylsilylpropan-2-amine (PubChem CID 102215132) has the molecular formula C28H29NOSi and a molecular weight of 423.63 g/mol. Its IUPAC name is (1R,2S)-1-methoxy-1-phenyl-N-triphenylsilylpropan-2-amine.
| Compound Name | (1R,2S)-1-methoxy-1-phenyl-N-triphenylsilylpropan-2-amine |
|---|---|
| PubChem CID | 102215132 |
| Molecular Formula | C28H29NOSi |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (1R,2S)-1-methoxy-1-phenyl-N-triphenylsilylpropan-2-amine |
| SMILES | CO[C@H](c1ccccc1)[C@H](C)N[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NOSi/c1-23(28(30-2)24-15-7-3-8-16-24)29-31(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23,28-29H,1-2H3/t23-,28-/m0/s1 |
| InChIKey | SYVAVMYLVODBOI-FIPFOOKPSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|