C17H25N2OPS — CID 23421675
(3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylprop-2-enoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole (PubChem CID 23421675) has the molecular formula C17H25N2OPS and a molecular weight of 336.44 g/mol. Its IUPAC name is (3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylprop-2-enoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole.
| Compound Name | (3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylprop-2-enoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole |
|---|---|
| PubChem CID | 23421675 |
| Molecular Formula | C17H25N2OPS |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylprop-2-enoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole |
| SMILES | C=C[C@@H](OP1(=S)N(C)[C@@H]2CCCC[C@H]2N1C)c1ccccc1 |
| InChI | InChI=1S/C17H25N2OPS/c1-4-17(14-10-6-5-7-11-14)20-21(22)18(2)15-12-8-9-13-16(15)19(21)3/h4-7,10-11,15-17H,1,8-9,12-13H2,2-3H3/t15-,16-,17-/m1/s1 |
| InChIKey | FAYHLLDMONOZBG-BRWVUGGUSA-N |
| XLogP | 4.34 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|