C24H45N2OPSSi2 — CID 23421755
[(3aR,7aR)-2-[(1R)-1-phenylbutoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane (PubChem CID 23421755) has the molecular formula C24H45N2OPSSi2 and a molecular weight of 496.85 g/mol. Its IUPAC name is [(3aR,7aR)-2-[(1R)-1-phenylbutoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane.
| Compound Name | [(3aR,7aR)-2-[(1R)-1-phenylbutoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 23421755 |
| Molecular Formula | C24H45N2OPSSi2 |
| Molecular Weight | 496.85 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | [(3aR,7aR)-2-[(1R)-1-phenylbutoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane |
| SMILES | CCC[C@@H](OP1(=S)N(C[Si](C)(C)C)[C@@H]2CCCC[C@H]2N1C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H45N2OPSSi2/c1-8-14-24(21-15-10-9-11-16-21)27-28(29)25(19-30(2,3)4)22-17-12-13-18-23(22)26(28)20-31(5,6)7/h9-11,15-16,22-24H,8,12-14,17-20H2,1-7H3/t22-,23-,24-/m1/s1 |
| InChIKey | SPCWHKMAYHJSAB-WXFUMESZSA-N |
| XLogP | 7.45 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.85 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|