C21H35NO — CID 10710619
(1R)-1-cyclohexyl-N-[(1R)-1-phenylbutoxy]pentan-1-amine (PubChem CID 10710619) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-N-[(1R)-1-phenylbutoxy]pentan-1-amine.
| Compound Name | (1R)-1-cyclohexyl-N-[(1R)-1-phenylbutoxy]pentan-1-amine |
|---|---|
| PubChem CID | 10710619 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (1R)-1-cyclohexyl-N-[(1R)-1-phenylbutoxy]pentan-1-amine |
| SMILES | CCCC[C@@H](NO[C@H](CCC)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H35NO/c1-3-5-17-20(18-13-8-6-9-14-18)22-23-21(12-4-2)19-15-10-7-11-16-19/h7,10-11,15-16,18,20-22H,3-6,8-9,12-14,17H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | ICBWIMISKZLTBJ-NHCUHLMSSA-N |
| XLogP | 6.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|