C17H26 — CID 139744385
1-cyclohexylpentan-2-ylbenzene (PubChem CID 139744385) has the molecular formula C17H26 and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-cyclohexylpentan-2-ylbenzene.
| Compound Name | 1-cyclohexylpentan-2-ylbenzene |
|---|---|
| PubChem CID | 139744385 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-cyclohexylpentan-2-ylbenzene |
| SMILES | CCCC(CC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H26/c1-2-9-17(16-12-7-4-8-13-16)14-15-10-5-3-6-11-15/h4,7-8,12-13,15,17H,2-3,5-6,9-11,14H2,1H3 |
| InChIKey | XTYCOOITKOXUNX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |