About cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene
cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene (PubChem CID 145163043) has the molecular formula C20H30
and a molecular weight of 270.46 g/mol. Its IUPAC name is cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene.
Molecular Properties
| Compound Name | cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene |
| PubChem CID | 145163043 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene |
| SMILES | C1CCC1.CCCC(c1ccccc1)C1C=CCCC1 |
| InChI | InChI=1S/C16H22.C4H8/c1-2-9-16(14-10-5-3-6-11-14)15-12-7-4-8-13-15;1-2-4-3-1/h3,5-7,10-12,15-16H,2,4,8-9,13H2,1H3;1-4H2 |
| InChIKey | JYDAATBNSYXXQF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene?
The IUPAC name of cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene (CID 145163043) is cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene.
What is the SMILES notation for cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene?
The canonical SMILES for cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene is C1CCC1.CCCC(c1ccccc1)C1C=CCCC1.
What is the InChIKey of cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene?
The InChIKey is JYDAATBNSYXXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22.C4H8/c1-2-9-16(14-10-5-3-6-11-14)15-12-7-4-8-13-15;1-2-4-3-1/h3,5-7,10-12,15-16H,2,4,8-9,13H2,1H3;1-4H2.
What are the key properties of cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene?
cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene has a molecular weight of 270.46 g/mol, XLogP of 6.49, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;1-cyclohex-2-en-1-ylbutylbenzene is sourced from PubChem (CID 145163043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).