C17H23NS — CID 10901776
N-[cyclohex-2-en-1-yl(phenyl)methyl]-2-methylpropanethioamide (PubChem CID 10901776) has the molecular formula C17H23NS and a molecular weight of 273.45 g/mol. Its IUPAC name is N-[cyclohex-2-en-1-yl(phenyl)methyl]-2-methylpropanethioamide.
| Compound Name | N-[cyclohex-2-en-1-yl(phenyl)methyl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 10901776 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-[cyclohex-2-en-1-yl(phenyl)methyl]-2-methylpropanethioamide |
| SMILES | CC(C)C(=S)NC(c1ccccc1)C1C=CCCC1 |
| InChI | InChI=1S/C17H23NS/c1-13(2)17(19)18-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3,5-7,9-11,13,15-16H,4,8,12H2,1-2H3,(H,18,19) |
| InChIKey | MSDUELAKZXJGNO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|