C17H25NO — CID 11402703
(3R)-N-[(1S)-1-phenylbutoxy]hepta-1,6-dien-3-amine (PubChem CID 11402703) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (3R)-N-[(1S)-1-phenylbutoxy]hepta-1,6-dien-3-amine.
| Compound Name | (3R)-N-[(1S)-1-phenylbutoxy]hepta-1,6-dien-3-amine |
|---|---|
| PubChem CID | 11402703 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (3R)-N-[(1S)-1-phenylbutoxy]hepta-1,6-dien-3-amine |
| SMILES | C=CCC[C@H](C=C)NO[C@@H](CCC)c1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-4-7-14-16(6-3)18-19-17(11-5-2)15-12-9-8-10-13-15/h4,6,8-10,12-13,16-18H,1,3,5,7,11,14H2,2H3/t16-,17-/m0/s1 |
| InChIKey | HOZFRGZSYFOYSQ-IRXDYDNUSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|