C14H18O — CID 101442843
(3S,4S)-3-phenylocta-1,7-dien-4-ol (PubChem CID 101442843) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (3S,4S)-3-phenylocta-1,7-dien-4-ol.
| Compound Name | (3S,4S)-3-phenylocta-1,7-dien-4-ol |
|---|---|
| PubChem CID | 101442843 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (3S,4S)-3-phenylocta-1,7-dien-4-ol |
| SMILES | C=CCC[C@H](O)[C@@H](C=C)c1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-3-5-11-14(15)13(4-2)12-9-7-6-8-10-12/h3-4,6-10,13-15H,1-2,5,11H2/t13-,14-/m0/s1 |
| InChIKey | KLIQIVYCWSZGFR-KBPBESRZSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|