C19H22 — CID 11097015
[(2S,3R)-2-phenylhept-6-en-3-yl]benzene (PubChem CID 11097015) has the molecular formula C19H22 and a molecular weight of 250.39 g/mol. Its IUPAC name is [(2S,3R)-2-phenylhept-6-en-3-yl]benzene.
| Compound Name | [(2S,3R)-2-phenylhept-6-en-3-yl]benzene |
|---|---|
| PubChem CID | 11097015 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [(2S,3R)-2-phenylhept-6-en-3-yl]benzene |
| SMILES | C=CCC[C@@H](c1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H22/c1-3-4-15-19(18-13-9-6-10-14-18)16(2)17-11-7-5-8-12-17/h3,5-14,16,19H,1,4,15H2,2H3/t16-,19-/m1/s1 |
| InChIKey | KVOYNYACNPSTGK-VQIMIIECSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|