About 1-bromohex-5-enylbenzene
1-bromohex-5-enylbenzene (PubChem CID 13296849) has the molecular formula C12H15Br
and a molecular weight of 239.16 g/mol. Its IUPAC name is 1-bromohex-5-enylbenzene.
Molecular Properties
| Compound Name | 1-bromohex-5-enylbenzene |
| PubChem CID | 13296849 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-bromohex-5-enylbenzene |
| SMILES | C=CCCCC(Br)c1ccccc1 |
| InChI | InChI=1S/C12H15Br/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h2,4,6-9,12H,1,3,5,10H2 |
| InChIKey | AGYYVSSKQLXJRJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromohex-5-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromohex-5-enylbenzene?
The IUPAC name of 1-bromohex-5-enylbenzene (CID 13296849) is 1-bromohex-5-enylbenzene.
What is the SMILES notation for 1-bromohex-5-enylbenzene?
The canonical SMILES for 1-bromohex-5-enylbenzene is C=CCCCC(Br)c1ccccc1.
What is the InChIKey of 1-bromohex-5-enylbenzene?
The InChIKey is AGYYVSSKQLXJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Br/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h2,4,6-9,12H,1,3,5,10H2.
What are the key properties of 1-bromohex-5-enylbenzene?
1-bromohex-5-enylbenzene has a molecular weight of 239.16 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromohex-5-enylbenzene is sourced from PubChem (CID 13296849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).