C22H24 — CID 144577995
[(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene (PubChem CID 144577995) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene.
| Compound Name | [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene |
|---|---|
| PubChem CID | 144577995 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene |
| SMILES | C=C/C=C(\C=C)CC(c1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C22H24/c1-4-12-19(5-2)17-22(21-15-10-7-11-16-21)18(3)20-13-8-6-9-14-20/h4-16,18,22H,1-2,17H2,3H3/b19-12+ |
| InChIKey | QHEDLEITVFIYSS-XDHOZWIPSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|