About [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene
[(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene (PubChem CID 144577995) has the molecular formula C22H24
and a molecular weight of 288.43 g/mol. Its IUPAC name is [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene.
Molecular Properties
| Compound Name | [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene |
| PubChem CID | 144577995 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene |
| SMILES | C=C/C=C(\C=C)CC(c1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C22H24/c1-4-12-19(5-2)17-22(21-15-10-7-11-16-21)18(3)20-13-8-6-9-14-20/h4-16,18,22H,1-2,17H2,3H3/b19-12+ |
| InChIKey | QHEDLEITVFIYSS-XDHOZWIPSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene?
The IUPAC name of [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene (CID 144577995) is [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene.
What is the SMILES notation for [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene?
The canonical SMILES for [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene is C=C/C=C(\C=C)CC(c1ccccc1)C(C)c1ccccc1.
What is the InChIKey of [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene?
The InChIKey is QHEDLEITVFIYSS-XDHOZWIPSA-N. The full InChI is InChI=1S/C22H24/c1-4-12-19(5-2)17-22(21-15-10-7-11-16-21)18(3)20-13-8-6-9-14-20/h4-16,18,22H,1-2,17H2,3H3/b19-12+.
What are the key properties of [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene?
[(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene has a molecular weight of 288.43 g/mol, XLogP of 6.26, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(5Z)-5-ethenyl-2-phenylocta-5,7-dien-3-yl]benzene is sourced from PubChem (CID 144577995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).