C15H19N — CID 143927593
(2E)-2-ethenyl-N-(1-phenylethyl)penta-2,4-dien-1-amine (PubChem CID 143927593) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (2E)-2-ethenyl-N-(1-phenylethyl)penta-2,4-dien-1-amine.
| Compound Name | (2E)-2-ethenyl-N-(1-phenylethyl)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143927593 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (2E)-2-ethenyl-N-(1-phenylethyl)penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C)CNC(C)c1ccccc1 |
| InChI | InChI=1S/C15H19N/c1-4-9-14(5-2)12-16-13(3)15-10-7-6-8-11-15/h4-11,13,16H,1-2,12H2,3H3/b14-9+ |
| InChIKey | PWQSXBQBGJDKMV-NTEUORMPSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|