C18H29NO — CID 10912755
(2R)-1-[(1S)-1-phenylbutoxy]-2-propylpiperidine (PubChem CID 10912755) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is (2R)-1-[(1S)-1-phenylbutoxy]-2-propylpiperidine.
| Compound Name | (2R)-1-[(1S)-1-phenylbutoxy]-2-propylpiperidine |
|---|---|
| PubChem CID | 10912755 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (2R)-1-[(1S)-1-phenylbutoxy]-2-propylpiperidine |
| SMILES | CCC[C@@H]1CCCCN1O[C@@H](CCC)c1ccccc1 |
| InChI | InChI=1S/C18H29NO/c1-3-10-17-14-8-9-15-19(17)20-18(11-4-2)16-12-6-5-7-13-16/h5-7,12-13,17-18H,3-4,8-11,14-15H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | BGSXFWOCDNHHGH-MSOLQXFVSA-N |
| XLogP | 5.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |