C22H27NO — CID 11067216
(2S)-2-phenyl-1-[(1S)-1-phenylbutoxy]-2,3,4,7-tetrahydroazepine (PubChem CID 11067216) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (2S)-2-phenyl-1-[(1S)-1-phenylbutoxy]-2,3,4,7-tetrahydroazepine.
| Compound Name | (2S)-2-phenyl-1-[(1S)-1-phenylbutoxy]-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 11067216 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2S)-2-phenyl-1-[(1S)-1-phenylbutoxy]-2,3,4,7-tetrahydroazepine |
| SMILES | CCC[C@H](ON1CC=CCC[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO/c1-2-12-22(20-15-8-4-9-16-20)24-23-18-11-5-10-17-21(23)19-13-6-3-7-14-19/h3-9,11,13-16,21-22H,2,10,12,17-18H2,1H3/t21-,22-/m0/s1 |
| InChIKey | QAOVTJJAZWYBPE-VXKWHMMOSA-N |
| XLogP | 5.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|