C21H36ClNO — CID 91166169
chloroethane;2,2,6,6-tetramethyl-1-(1-phenylbutoxy)piperidine (PubChem CID 91166169) has the molecular formula C21H36ClNO and a molecular weight of 353.98 g/mol. Its IUPAC name is chloroethane;2,2,6,6-tetramethyl-1-(1-phenylbutoxy)piperidine.
| Compound Name | chloroethane;2,2,6,6-tetramethyl-1-(1-phenylbutoxy)piperidine |
|---|---|
| PubChem CID | 91166169 |
| Molecular Formula | C21H36ClNO |
| Molecular Weight | 353.98 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | chloroethane;2,2,6,6-tetramethyl-1-(1-phenylbutoxy)piperidine |
| SMILES | CCCC(ON1C(C)(C)CCCC1(C)C)c1ccccc1.CCCl |
| InChI | InChI=1S/C19H31NO.C2H5Cl/c1-6-11-17(16-12-8-7-9-13-16)21-20-18(2,3)14-10-15-19(20,4)5;1-2-3/h7-9,12-13,17H,6,10-11,14-15H2,1-5H3;2H2,1H3 |
| InChIKey | VOIJWNULOJYVJA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.98 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|