C24H31NO2 — CID 57081141
1,3-diphenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-1-one (PubChem CID 57081141) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 1,3-diphenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-1-one.
| Compound Name | 1,3-diphenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-1-one |
|---|---|
| PubChem CID | 57081141 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 1,3-diphenyl-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-1-one |
| SMILES | CC1(C)CCCC(C)(C)N1OC(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-23(2)16-11-17-24(3,4)25(23)27-22(20-14-9-6-10-15-20)18-21(26)19-12-7-5-8-13-19/h5-10,12-15,22H,11,16-18H2,1-4H3 |
| InChIKey | PMTZUOIIBQIGIL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |