C34H51N3O4 — CID 139052130
methyl N-[(S)-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-N-[2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]phenyl]carbamate (PubChem CID 139052130) has the molecular formula C34H51N3O4 and a molecular weight of 565.80 g/mol. Its IUPAC name is methyl N-[(S)-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-N-[2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]phenyl]carbamate.
| Compound Name | methyl N-[(S)-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-N-[2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 139052130 |
| Molecular Formula | C34H51N3O4 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.39 |
| IUPAC Name | methyl N-[(S)-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-N-[2-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]phenyl]carbamate |
| SMILES | COC(=O)N(c1ccccc1CON1C(C)(C)CCCC1(C)C)[C@@H](ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H51N3O4/c1-31(2)21-15-22-32(3,4)36(31)40-25-27-19-13-14-20-28(27)35(30(38)39-9)29(26-17-11-10-12-18-26)41-37-33(5,6)23-16-24-34(37,7)8/h10-14,17-20,29H,15-16,21-25H2,1-9H3/t29-/m0/s1 |
| InChIKey | PDWWLMMLZHIKEX-LJAQVGFWSA-N |
| XLogP | 8.41 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|