C19H28N4O3 — CID 102140721
methyl (2R,3R)-3-azido-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate (PubChem CID 102140721) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is methyl (2R,3R)-3-azido-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate.
| Compound Name | methyl (2R,3R)-3-azido-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate |
|---|---|
| PubChem CID | 102140721 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | methyl (2R,3R)-3-azido-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate |
| SMILES | COC(=O)[C@H](ON1C(C)(C)CCCC1(C)C)[C@H](N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C19H28N4O3/c1-18(2)12-9-13-19(3,4)23(18)26-16(17(24)25-5)15(21-22-20)14-10-7-6-8-11-14/h6-8,10-11,15-16H,9,12-13H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | FQLYBIRUOBWOTL-HZPDHXFCSA-N |
| XLogP | 4.55 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|